C14H18N2O3S — CID 4628428
3-(4-methylphenyl)sulfonyl-1,1-bis(prop-2-enyl)urea (PubChem CID 4628428) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is 3-(4-methylphenyl)sulfonyl-1,1-bis(prop-2-enyl)urea.
| Compound Name | 3-(4-methylphenyl)sulfonyl-1,1-bis(prop-2-enyl)urea |
|---|---|
| PubChem CID | 4628428 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 3-(4-methylphenyl)sulfonyl-1,1-bis(prop-2-enyl)urea |
| SMILES | C=CCN(CC=C)C(=O)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H18N2O3S/c1-4-10-16(11-5-2)14(17)15-20(18,19)13-8-6-12(3)7-9-13/h4-9H,1-2,10-11H2,3H3,(H,15,17) |
| InChIKey | WJAAVMYBGVEWNM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|