C15H17NO2 — CID 78843339
2-(4-methylphenyl)-2-oxo-N,N-bis(prop-2-enyl)acetamide (PubChem CID 78843339) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is 2-(4-methylphenyl)-2-oxo-N,N-bis(prop-2-enyl)acetamide.
| Compound Name | 2-(4-methylphenyl)-2-oxo-N,N-bis(prop-2-enyl)acetamide |
|---|---|
| PubChem CID | 78843339 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 2-(4-methylphenyl)-2-oxo-N,N-bis(prop-2-enyl)acetamide |
| SMILES | C=CCN(CC=C)C(=O)C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H17NO2/c1-4-10-16(11-5-2)15(18)14(17)13-8-6-12(3)7-9-13/h4-9H,1-2,10-11H2,3H3 |
| InChIKey | QTFGNEZFCMTLBX-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|