C23H26N2O5S — CID 16514948
[2-[bis(prop-2-enyl)amino]-2-oxoethyl] 4-[methyl-(4-methylphenyl)sulfonylamino]benzoate (PubChem CID 16514948) has the molecular formula C23H26N2O5S and a molecular weight of 442.54 g/mol. Its IUPAC name is [2-[bis(prop-2-enyl)amino]-2-oxoethyl] 4-[methyl-(4-methylphenyl)sulfonylamino]benzoate.
| Compound Name | [2-[bis(prop-2-enyl)amino]-2-oxoethyl] 4-[methyl-(4-methylphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 16514948 |
| Molecular Formula | C23H26N2O5S |
| Molecular Weight | 442.54 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | [2-[bis(prop-2-enyl)amino]-2-oxoethyl] 4-[methyl-(4-methylphenyl)sulfonylamino]benzoate |
| SMILES | C=CCN(CC=C)C(=O)COC(=O)c1ccc(N(C)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H26N2O5S/c1-5-15-25(16-6-2)22(26)17-30-23(27)19-9-11-20(12-10-19)24(4)31(28,29)21-13-7-18(3)8-14-21/h5-14H,1-2,15-17H2,3-4H3 |
| InChIKey | PCRPERBLGQUCMD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.54 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|