C26H32N2O5S — CID 16511656
[2-[bis(prop-2-enyl)amino]-2-oxoethyl] 4-[[(4-tert-butylphenyl)sulfonylamino]methyl]benzoate (PubChem CID 16511656) has the molecular formula C26H32N2O5S and a molecular weight of 484.62 g/mol. Its IUPAC name is [2-[bis(prop-2-enyl)amino]-2-oxoethyl] 4-[[(4-tert-butylphenyl)sulfonylamino]methyl]benzoate.
| Compound Name | [2-[bis(prop-2-enyl)amino]-2-oxoethyl] 4-[[(4-tert-butylphenyl)sulfonylamino]methyl]benzoate |
|---|---|
| PubChem CID | 16511656 |
| Molecular Formula | C26H32N2O5S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.20 |
| IUPAC Name | [2-[bis(prop-2-enyl)amino]-2-oxoethyl] 4-[[(4-tert-butylphenyl)sulfonylamino]methyl]benzoate |
| SMILES | C=CCN(CC=C)C(=O)COC(=O)c1ccc(CNS(=O)(=O)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C26H32N2O5S/c1-6-16-28(17-7-2)24(29)19-33-25(30)21-10-8-20(9-11-21)18-27-34(31,32)23-14-12-22(13-15-23)26(3,4)5/h6-15,27H,1-2,16-19H2,3-5H3 |
| InChIKey | SBYQMKJFMPUSSY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|