C11H13NO3S2 — CID 88768451
S-prop-2-enyl N-(4-methylphenyl)sulfonylcarbamothioate (PubChem CID 88768451) has the molecular formula C11H13NO3S2 and a molecular weight of 271.36 g/mol. Its IUPAC name is S-prop-2-enyl N-(4-methylphenyl)sulfonylcarbamothioate.
| Compound Name | S-prop-2-enyl N-(4-methylphenyl)sulfonylcarbamothioate |
|---|---|
| PubChem CID | 88768451 |
| Molecular Formula | C11H13NO3S2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | S-prop-2-enyl N-(4-methylphenyl)sulfonylcarbamothioate |
| SMILES | C=CCSC(=O)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C11H13NO3S2/c1-3-8-16-11(13)12-17(14,15)10-6-4-9(2)5-7-10/h3-7H,1,8H2,2H3,(H,12,13) |
| InChIKey | SAFSXMDPWQEWTH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|