C12H14N2O4S — CID 54560302
2-methylidene-N-(4-methylphenyl)sulfonylbutanediamide (PubChem CID 54560302) has the molecular formula C12H14N2O4S and a molecular weight of 282.32 g/mol. Its IUPAC name is 2-methylidene-N-(4-methylphenyl)sulfonylbutanediamide.
| Compound Name | 2-methylidene-N-(4-methylphenyl)sulfonylbutanediamide |
|---|---|
| PubChem CID | 54560302 |
| Molecular Formula | C12H14N2O4S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 2-methylidene-N-(4-methylphenyl)sulfonylbutanediamide |
| SMILES | C=C(CC(N)=O)C(=O)NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C12H14N2O4S/c1-8-3-5-10(6-4-8)19(17,18)14-12(16)9(2)7-11(13)15/h3-6H,2,7H2,1H3,(H2,13,15)(H,14,16) |
| InChIKey | ZQBPFIHQWMPIFN-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|