C20H28ClNO4S — CID 56981764
6-[1-[2-[(4-chlorophenyl)sulfonylamino]ethyl]cyclohexyl]hex-4-enoic acid (PubChem CID 56981764) has the molecular formula C20H28ClNO4S and a molecular weight of 413.97 g/mol. Its IUPAC name is 6-[1-[2-[(4-chlorophenyl)sulfonylamino]ethyl]cyclohexyl]hex-4-enoic acid.
| Compound Name | 6-[1-[2-[(4-chlorophenyl)sulfonylamino]ethyl]cyclohexyl]hex-4-enoic acid |
|---|---|
| PubChem CID | 56981764 |
| Molecular Formula | C20H28ClNO4S |
| Molecular Weight | 413.97 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 6-[1-[2-[(4-chlorophenyl)sulfonylamino]ethyl]cyclohexyl]hex-4-enoic acid |
| SMILES | O=C(O)CCC=CCC1(CCNS(=O)(=O)c2ccc(Cl)cc2)CCCCC1 |
| InChI | InChI=1S/C20H28ClNO4S/c21-17-8-10-18(11-9-17)27(25,26)22-16-15-20(13-5-2-6-14-20)12-4-1-3-7-19(23)24/h1,4,8-11,22H,2-3,5-7,12-16H2,(H,23,24) |
| InChIKey | RYVUSCCRBKTXEL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.97 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|