C23H30ClNO4S — CID 162054654
acetic acid;4-chloro-N-[[1-[(4-ethylphenyl)methyl]cyclopentyl]methyl]benzenesulfonamide (PubChem CID 162054654) has the molecular formula C23H30ClNO4S and a molecular weight of 452.02 g/mol. Its IUPAC name is acetic acid;4-chloro-N-[[1-[(4-ethylphenyl)methyl]cyclopentyl]methyl]benzenesulfonamide.
| Compound Name | acetic acid;4-chloro-N-[[1-[(4-ethylphenyl)methyl]cyclopentyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 162054654 |
| Molecular Formula | C23H30ClNO4S |
| Molecular Weight | 452.02 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | acetic acid;4-chloro-N-[[1-[(4-ethylphenyl)methyl]cyclopentyl]methyl]benzenesulfonamide |
| SMILES | CC(=O)O.CCc1ccc(CC2(CNS(=O)(=O)c3ccc(Cl)cc3)CCCC2)cc1 |
| InChI | InChI=1S/C21H26ClNO2S.C2H4O2/c1-2-17-5-7-18(8-6-17)15-21(13-3-4-14-21)16-23-26(24,25)20-11-9-19(22)10-12-20;1-2(3)4/h5-12,23H,2-4,13-16H2,1H3;1H3,(H,3,4) |
| InChIKey | XLQQXRVVKHIWQC-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.02 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |