C21H26ClNO3S — CID 11976887
4-chloro-N-[[1-[[3-(2-hydroxyethyl)phenyl]methyl]cyclopentyl]methyl]benzenesulfonamide (PubChem CID 11976887) has the molecular formula C21H26ClNO3S and a molecular weight of 407.96 g/mol. Its IUPAC name is 4-chloro-N-[[1-[[3-(2-hydroxyethyl)phenyl]methyl]cyclopentyl]methyl]benzenesulfonamide.
| Compound Name | 4-chloro-N-[[1-[[3-(2-hydroxyethyl)phenyl]methyl]cyclopentyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 11976887 |
| Molecular Formula | C21H26ClNO3S |
| Molecular Weight | 407.96 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 4-chloro-N-[[1-[[3-(2-hydroxyethyl)phenyl]methyl]cyclopentyl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NCC1(Cc2cccc(CCO)c2)CCCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H26ClNO3S/c22-19-6-8-20(9-7-19)27(25,26)23-16-21(11-1-2-12-21)15-18-5-3-4-17(14-18)10-13-24/h3-9,14,23-24H,1-2,10-13,15-16H2 |
| InChIKey | GQQAZVQVVQBBPI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.96 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |