C20H17Cl2NO3S — CID 25094423
4-(2,4-dichlorophenyl)-N-[3-(2-hydroxyethyl)phenyl]benzenesulfonamide (PubChem CID 25094423) has the molecular formula C20H17Cl2NO3S and a molecular weight of 422.33 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-N-[3-(2-hydroxyethyl)phenyl]benzenesulfonamide.
| Compound Name | 4-(2,4-dichlorophenyl)-N-[3-(2-hydroxyethyl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 25094423 |
| Molecular Formula | C20H17Cl2NO3S |
| Molecular Weight | 422.33 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-N-[3-(2-hydroxyethyl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(CCO)c1)c1ccc(-c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C20H17Cl2NO3S/c21-16-6-9-19(20(22)13-16)15-4-7-18(8-5-15)27(25,26)23-17-3-1-2-14(12-17)10-11-24/h1-9,12-13,23-24H,10-11H2 |
| InChIKey | NMZXRSUKNBTHPJ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.33 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |