C18H14Cl2N2O4S2 — CID 45138636
3-[[4-(2,4-dichlorophenyl)phenyl]sulfonylamino]benzenesulfonamide (PubChem CID 45138636) has the molecular formula C18H14Cl2N2O4S2 and a molecular weight of 457.36 g/mol. Its IUPAC name is 3-[[4-(2,4-dichlorophenyl)phenyl]sulfonylamino]benzenesulfonamide.
| Compound Name | 3-[[4-(2,4-dichlorophenyl)phenyl]sulfonylamino]benzenesulfonamide |
|---|---|
| PubChem CID | 45138636 |
| Molecular Formula | C18H14Cl2N2O4S2 |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 455.98 |
| IUPAC Name | 3-[[4-(2,4-dichlorophenyl)phenyl]sulfonylamino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(NS(=O)(=O)c2ccc(-c3ccc(Cl)cc3Cl)cc2)c1 |
| InChI | InChI=1S/C18H14Cl2N2O4S2/c19-13-6-9-17(18(20)10-13)12-4-7-15(8-5-12)28(25,26)22-14-2-1-3-16(11-14)27(21,23)24/h1-11,22H,(H2,21,23,24) |
| InChIKey | AQTQXTPLMSHXAF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |