C19H12Cl2N2O2S — CID 155927046
N-(3-cyanophenyl)-4-(2,4-dichlorophenyl)benzenesulfonamide (PubChem CID 155927046) has the molecular formula C19H12Cl2N2O2S and a molecular weight of 403.29 g/mol. Its IUPAC name is N-(3-cyanophenyl)-4-(2,4-dichlorophenyl)benzenesulfonamide.
| Compound Name | N-(3-cyanophenyl)-4-(2,4-dichlorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 155927046 |
| Molecular Formula | C19H12Cl2N2O2S |
| Molecular Weight | 403.29 g/mol |
| Exact Mass | 402.00 |
| IUPAC Name | N-(3-cyanophenyl)-4-(2,4-dichlorophenyl)benzenesulfonamide |
| SMILES | N#Cc1cccc(NS(=O)(=O)c2ccc(-c3ccc(Cl)cc3Cl)cc2)c1 |
| InChI | InChI=1S/C19H12Cl2N2O2S/c20-15-6-9-18(19(21)11-15)14-4-7-17(8-5-14)26(24,25)23-16-3-1-2-13(10-16)12-22/h1-11,23H |
| InChIKey | SYMYSFAYEIZOMA-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.29 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |