About 4-(2,4-difluorophenyl)-N-[3-(hydroxymethyl)phenyl]benzenesulfonamide;ethane
4-(2,4-difluorophenyl)-N-[3-(hydroxymethyl)phenyl]benzenesulfonamide;ethane (PubChem CID 145477038) has the molecular formula C21H21F2NO3S
and a molecular weight of 405.47 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-N-[3-(hydroxymethyl)phenyl]benzenesulfonamide;ethane.
Molecular Properties
| Compound Name | 4-(2,4-difluorophenyl)-N-[3-(hydroxymethyl)phenyl]benzenesulfonamide;ethane |
| PubChem CID | 145477038 |
| Molecular Formula | C21H21F2NO3S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 4-(2,4-difluorophenyl)-N-[3-(hydroxymethyl)phenyl]benzenesulfonamide;ethane |
| SMILES | CC.O=S(=O)(Nc1cccc(CO)c1)c1ccc(-c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C19H15F2NO3S.C2H6/c20-15-6-9-18(19(21)11-15)14-4-7-17(8-5-14)26(24,25)22-16-3-1-2-13(10-16)12-23;1-2/h1-11,22-23H,12H2;1-2H3 |
| InChIKey | CQXBSMASARUSNF-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2,4-difluorophenyl)-N-[3-(hydroxymethyl)phenyl]benzenesulfonamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-difluorophenyl)-N-[3-(hydroxymethyl)phenyl]benzenesulfonamide;ethane?
The IUPAC name of 4-(2,4-difluorophenyl)-N-[3-(hydroxymethyl)phenyl]benzenesulfonamide;ethane (CID 145477038) is 4-(2,4-difluorophenyl)-N-[3-(hydroxymethyl)phenyl]benzenesulfonamide;ethane.
What is the SMILES notation for 4-(2,4-difluorophenyl)-N-[3-(hydroxymethyl)phenyl]benzenesulfonamide;ethane?
The canonical SMILES for 4-(2,4-difluorophenyl)-N-[3-(hydroxymethyl)phenyl]benzenesulfonamide;ethane is CC.O=S(=O)(Nc1cccc(CO)c1)c1ccc(-c2ccc(F)cc2F)cc1.
What is the InChIKey of 4-(2,4-difluorophenyl)-N-[3-(hydroxymethyl)phenyl]benzenesulfonamide;ethane?
The InChIKey is CQXBSMASARUSNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15F2NO3S.C2H6/c20-15-6-9-18(19(21)11-15)14-4-7-17(8-5-14)26(24,25)22-16-3-1-2-13(10-16)12-23;1-2/h1-11,22-23H,12H2;1-2H3.
What are the key properties of 4-(2,4-difluorophenyl)-N-[3-(hydroxymethyl)phenyl]benzenesulfonamide;ethane?
4-(2,4-difluorophenyl)-N-[3-(hydroxymethyl)phenyl]benzenesulfonamide;ethane has a molecular weight of 405.47 g/mol, XLogP of 4.95, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-difluorophenyl)-N-[3-(hydroxymethyl)phenyl]benzenesulfonamide;ethane is sourced from PubChem (CID 145477038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).