C22H19F2NO5S — CID 25095243
ethyl 2-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylamino]-2-hydroxyphenyl]acetate (PubChem CID 25095243) has the molecular formula C22H19F2NO5S and a molecular weight of 447.46 g/mol. Its IUPAC name is ethyl 2-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylamino]-2-hydroxyphenyl]acetate.
| Compound Name | ethyl 2-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylamino]-2-hydroxyphenyl]acetate |
|---|---|
| PubChem CID | 25095243 |
| Molecular Formula | C22H19F2NO5S |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | ethyl 2-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylamino]-2-hydroxyphenyl]acetate |
| SMILES | CCOC(=O)Cc1cccc(NS(=O)(=O)c2ccc(-c3ccc(F)cc3F)cc2)c1O |
| InChI | InChI=1S/C22H19F2NO5S/c1-2-30-21(26)12-15-4-3-5-20(22(15)27)25-31(28,29)17-9-6-14(7-10-17)18-11-8-16(23)13-19(18)24/h3-11,13,25,27H,2,12H2,1H3 |
| InChIKey | YZIVYTUUHXNWOX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|