C19H16F2N2O3S — CID 134479081
N-[3-[(R)-amino(hydroxy)methyl]phenyl]-4-(2,4-difluorophenyl)benzenesulfonamide (PubChem CID 134479081) has the molecular formula C19H16F2N2O3S and a molecular weight of 390.41 g/mol. Its IUPAC name is N-[3-[(R)-amino(hydroxy)methyl]phenyl]-4-(2,4-difluorophenyl)benzenesulfonamide.
| Compound Name | N-[3-[(R)-amino(hydroxy)methyl]phenyl]-4-(2,4-difluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 134479081 |
| Molecular Formula | C19H16F2N2O3S |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | N-[3-[(R)-amino(hydroxy)methyl]phenyl]-4-(2,4-difluorophenyl)benzenesulfonamide |
| SMILES | N[C@H](O)c1cccc(NS(=O)(=O)c2ccc(-c3ccc(F)cc3F)cc2)c1 |
| InChI | InChI=1S/C19H16F2N2O3S/c20-14-6-9-17(18(21)11-14)12-4-7-16(8-5-12)27(25,26)23-15-3-1-2-13(10-15)19(22)24/h1-11,19,23-24H,22H2/t19-/m1/s1 |
| InChIKey | YPXKDFQOOLMELV-LJQANCHMSA-N |
| XLogP | 3.38 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|