About 2-amino-1-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]ethanol
2-amino-1-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]ethanol (PubChem CID 58378809) has the molecular formula C21H19F2NO3S
and a molecular weight of 403.45 g/mol. Its IUPAC name is 2-amino-1-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]ethanol.
Molecular Properties
| Compound Name | 2-amino-1-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]ethanol |
| PubChem CID | 58378809 |
| Molecular Formula | C21H19F2NO3S |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 2-amino-1-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]ethanol |
| SMILES | NCC(O)c1cccc(CS(=O)(=O)c2ccc(-c3ccc(F)cc3F)cc2)c1 |
| InChI | InChI=1S/C21H19F2NO3S/c22-17-6-9-19(20(23)11-17)15-4-7-18(8-5-15)28(26,27)13-14-2-1-3-16(10-14)21(25)12-24/h1-11,21,25H,12-13,24H2 |
| InChIKey | SCUMYPQQLIPQFS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-1-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]ethanol?
The IUPAC name of 2-amino-1-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]ethanol (CID 58378809) is 2-amino-1-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]ethanol.
What is the SMILES notation for 2-amino-1-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]ethanol?
The canonical SMILES for 2-amino-1-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]ethanol is NCC(O)c1cccc(CS(=O)(=O)c2ccc(-c3ccc(F)cc3F)cc2)c1.
What is the InChIKey of 2-amino-1-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]ethanol?
The InChIKey is SCUMYPQQLIPQFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19F2NO3S/c22-17-6-9-19(20(23)11-17)15-4-7-18(8-5-15)28(26,27)13-14-2-1-3-16(10-14)21(25)12-24/h1-11,21,25H,12-13,24H2.
What are the key properties of 2-amino-1-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]ethanol?
2-amino-1-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]ethanol has a molecular weight of 403.45 g/mol, XLogP of 3.60, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-[3-[[4-(2,4-difluorophenyl)phenyl]sulfonylmethyl]phenyl]ethanol is sourced from PubChem (CID 58378809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).