C25H38ClNO4S — CID 139629556
methyl (Z)-6-[4-tert-butyl-1-[2-[(4-chlorophenyl)sulfonylamino]ethyl]cyclohexyl]hex-4-enoate (PubChem CID 139629556) has the molecular formula C25H38ClNO4S and a molecular weight of 484.10 g/mol. Its IUPAC name is methyl (Z)-6-[4-tert-butyl-1-[2-[(4-chlorophenyl)sulfonylamino]ethyl]cyclohexyl]hex-4-enoate.
| Compound Name | methyl (Z)-6-[4-tert-butyl-1-[2-[(4-chlorophenyl)sulfonylamino]ethyl]cyclohexyl]hex-4-enoate |
|---|---|
| PubChem CID | 139629556 |
| Molecular Formula | C25H38ClNO4S |
| Molecular Weight | 484.10 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | methyl (Z)-6-[4-tert-butyl-1-[2-[(4-chlorophenyl)sulfonylamino]ethyl]cyclohexyl]hex-4-enoate |
| SMILES | COC(=O)CC/C=C\CC1(CCNS(=O)(=O)c2ccc(Cl)cc2)CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C25H38ClNO4S/c1-24(2,3)20-13-16-25(17-14-20,15-7-5-6-8-23(28)31-4)18-19-27-32(29,30)22-11-9-21(26)10-12-22/h5,7,9-12,20,27H,6,8,13-19H2,1-4H3/b7-5- |
| InChIKey | PYGDRXGIZWFUGF-ALCCZGGFSA-N |
| XLogP | 6.13 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.10 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|