C20H26ClNO4S — CID 67929210
methyl (Z)-6-[3-[(4-chlorophenyl)sulfonylamino]-2-bicyclo[2.2.1]heptanyl]hex-5-enoate (PubChem CID 67929210) has the molecular formula C20H26ClNO4S and a molecular weight of 411.95 g/mol. Its IUPAC name is methyl (Z)-6-[3-[(4-chlorophenyl)sulfonylamino]-2-bicyclo[2.2.1]heptanyl]hex-5-enoate.
| Compound Name | methyl (Z)-6-[3-[(4-chlorophenyl)sulfonylamino]-2-bicyclo[2.2.1]heptanyl]hex-5-enoate |
|---|---|
| PubChem CID | 67929210 |
| Molecular Formula | C20H26ClNO4S |
| Molecular Weight | 411.95 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | methyl (Z)-6-[3-[(4-chlorophenyl)sulfonylamino]-2-bicyclo[2.2.1]heptanyl]hex-5-enoate |
| SMILES | COC(=O)CCC/C=C\C1C2CCC(C2)C1NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H26ClNO4S/c1-26-19(23)6-4-2-3-5-18-14-7-8-15(13-14)20(18)22-27(24,25)17-11-9-16(21)10-12-17/h3,5,9-12,14-15,18,20,22H,2,4,6-8,13H2,1H3/b5-3- |
| InChIKey | BSXMLBWPCNHTLV-HYXAFXHYSA-N |
| XLogP | 3.93 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.95 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|