C10H11Cl2NO4S — CID 3874327
methyl 3-[(3,5-dichlorophenyl)sulfonylamino]propanoate (PubChem CID 3874327) has the molecular formula C10H11Cl2NO4S and a molecular weight of 312.17 g/mol. Its IUPAC name is methyl 3-[(3,5-dichlorophenyl)sulfonylamino]propanoate.
| Compound Name | methyl 3-[(3,5-dichlorophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 3874327 |
| Molecular Formula | C10H11Cl2NO4S |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 310.98 |
| IUPAC Name | methyl 3-[(3,5-dichlorophenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)CCNS(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C10H11Cl2NO4S/c1-17-10(14)2-3-13-18(15,16)9-5-7(11)4-8(12)6-9/h4-6,13H,2-3H2,1H3 |
| InChIKey | YOTLPPLQBOKANL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |