C24H35ClNNaO4S — CID 139629554
sodium (Z)-6-[4-tert-butyl-1-[2-[(4-chlorophenyl)sulfonylamino]ethyl]cyclohexyl]hex-4-enoate (PubChem CID 139629554) has the molecular formula C24H35ClNNaO4S and a molecular weight of 492.06 g/mol. Its IUPAC name is sodium (Z)-6-[4-tert-butyl-1-[2-[(4-chlorophenyl)sulfonylamino]ethyl]cyclohexyl]hex-4-enoate.
| Compound Name | sodium (Z)-6-[4-tert-butyl-1-[2-[(4-chlorophenyl)sulfonylamino]ethyl]cyclohexyl]hex-4-enoate |
|---|---|
| PubChem CID | 139629554 |
| Molecular Formula | C24H35ClNNaO4S |
| Molecular Weight | 492.06 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | sodium (Z)-6-[4-tert-butyl-1-[2-[(4-chlorophenyl)sulfonylamino]ethyl]cyclohexyl]hex-4-enoate |
| SMILES | CC(C)(C)C1CCC(C/C=C\CCC(=O)[O-])(CCNS(=O)(=O)c2ccc(Cl)cc2)CC1.[Na+] |
| InChI | InChI=1S/C24H36ClNO4S.Na/c1-23(2,3)19-12-15-24(16-13-19,14-6-4-5-7-22(27)28)17-18-26-31(29,30)21-10-8-20(25)9-11-21;/h4,6,8-11,19,26H,5,7,12-18H2,1-3H3,(H,27,28);/q;+1/p-1/b6-4-; |
| InChIKey | KNHCBLROPKFKQR-YHSAGPEESA-M |
| XLogP | 1.71 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.06 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|