C13H18ClN3O3S — CID 4165843
N-[3-(2-but-2-en-2-ylhydrazinyl)-3-oxopropyl]-4-chlorobenzenesulfonamide (PubChem CID 4165843) has the molecular formula C13H18ClN3O3S and a molecular weight of 331.83 g/mol. Its IUPAC name is N-[3-(2-but-2-en-2-ylhydrazinyl)-3-oxopropyl]-4-chlorobenzenesulfonamide.
| Compound Name | N-[3-(2-but-2-en-2-ylhydrazinyl)-3-oxopropyl]-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 4165843 |
| Molecular Formula | C13H18ClN3O3S |
| Molecular Weight | 331.83 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | N-[3-(2-but-2-en-2-ylhydrazinyl)-3-oxopropyl]-4-chlorobenzenesulfonamide |
| SMILES | CC=C(C)NNC(=O)CCNS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H18ClN3O3S/c1-3-10(2)16-17-13(18)8-9-15-21(19,20)12-6-4-11(14)5-7-12/h3-7,15-16H,8-9H2,1-2H3,(H,17,18) |
| InChIKey | WSYCJHPYXPICLR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.83 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|