C14H20ClN3O4S — CID 17411620
2-[3-[(4-chlorophenyl)sulfonylamino]propanoylamino]-N-ethylpropanamide (PubChem CID 17411620) has the molecular formula C14H20ClN3O4S and a molecular weight of 361.85 g/mol. Its IUPAC name is 2-[3-[(4-chlorophenyl)sulfonylamino]propanoylamino]-N-ethylpropanamide.
| Compound Name | 2-[3-[(4-chlorophenyl)sulfonylamino]propanoylamino]-N-ethylpropanamide |
|---|---|
| PubChem CID | 17411620 |
| Molecular Formula | C14H20ClN3O4S |
| Molecular Weight | 361.85 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 2-[3-[(4-chlorophenyl)sulfonylamino]propanoylamino]-N-ethylpropanamide |
| SMILES | CCNC(=O)C(C)NC(=O)CCNS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H20ClN3O4S/c1-3-16-14(20)10(2)18-13(19)8-9-17-23(21,22)12-6-4-11(15)5-7-12/h4-7,10,17H,3,8-9H2,1-2H3,(H,16,20)(H,18,19) |
| InChIKey | RBAFORTZOLVYOA-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.85 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |