C15H17ClN2O3S2 — CID 24543595
3-[(4-chlorophenyl)sulfonylamino]-N-(1-thiophen-2-ylethyl)propanamide (PubChem CID 24543595) has the molecular formula C15H17ClN2O3S2 and a molecular weight of 372.90 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)sulfonylamino]-N-(1-thiophen-2-ylethyl)propanamide.
| Compound Name | 3-[(4-chlorophenyl)sulfonylamino]-N-(1-thiophen-2-ylethyl)propanamide |
|---|---|
| PubChem CID | 24543595 |
| Molecular Formula | C15H17ClN2O3S2 |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 3-[(4-chlorophenyl)sulfonylamino]-N-(1-thiophen-2-ylethyl)propanamide |
| SMILES | CC(NC(=O)CCNS(=O)(=O)c1ccc(Cl)cc1)c1cccs1 |
| InChI | InChI=1S/C15H17ClN2O3S2/c1-11(14-3-2-10-22-14)18-15(19)8-9-17-23(20,21)13-6-4-12(16)5-7-13/h2-7,10-11,17H,8-9H2,1H3,(H,18,19) |
| InChIKey | FZEYZZYNQGJRIR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |