C11H14O3S — CID 115035637
[1-(3-methylphenyl)sulfonylcyclopropyl]methanol (PubChem CID 115035637) has the molecular formula C11H14O3S and a molecular weight of 226.30 g/mol. Its IUPAC name is [1-(3-methylphenyl)sulfonylcyclopropyl]methanol.
| Compound Name | [1-(3-methylphenyl)sulfonylcyclopropyl]methanol |
|---|---|
| PubChem CID | 115035637 |
| Molecular Formula | C11H14O3S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.07 |
| IUPAC Name | [1-(3-methylphenyl)sulfonylcyclopropyl]methanol |
| SMILES | Cc1cccc(S(=O)(=O)C2(CO)CC2)c1 |
| InChI | InChI=1S/C11H14O3S/c1-9-3-2-4-10(7-9)15(13,14)11(8-12)5-6-11/h2-4,7,12H,5-6,8H2,1H3 |
| InChIKey | HEACKOCUWWGDFT-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |