C15H22N2O4S — CID 118445075
4-ethyl-N'-hydroxy-4-(3-methylphenyl)sulfonyloxane-2-carboximidamide (PubChem CID 118445075) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is 4-ethyl-N'-hydroxy-4-(3-methylphenyl)sulfonyloxane-2-carboximidamide.
| Compound Name | 4-ethyl-N'-hydroxy-4-(3-methylphenyl)sulfonyloxane-2-carboximidamide |
|---|---|
| PubChem CID | 118445075 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 4-ethyl-N'-hydroxy-4-(3-methylphenyl)sulfonyloxane-2-carboximidamide |
| SMILES | CCC1(S(=O)(=O)c2cccc(C)c2)CCOC(/C(N)=N/O)C1 |
| InChI | InChI=1S/C15H22N2O4S/c1-3-15(7-8-21-13(10-15)14(16)17-18)22(19,20)12-6-4-5-11(2)9-12/h4-6,9,13,18H,3,7-8,10H2,1-2H3,(H2,16,17) |
| InChIKey | UATDQZKFUMEXTA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|