C19H21ClO3S — CID 118443628
(2S,4S)-2-(4-chlorophenyl)-4-methyl-4-(3-methylphenyl)sulfonyloxane (PubChem CID 118443628) has the molecular formula C19H21ClO3S and a molecular weight of 364.89 g/mol. Its IUPAC name is (2S,4S)-2-(4-chlorophenyl)-4-methyl-4-(3-methylphenyl)sulfonyloxane.
| Compound Name | (2S,4S)-2-(4-chlorophenyl)-4-methyl-4-(3-methylphenyl)sulfonyloxane |
|---|---|
| PubChem CID | 118443628 |
| Molecular Formula | C19H21ClO3S |
| Molecular Weight | 364.89 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | (2S,4S)-2-(4-chlorophenyl)-4-methyl-4-(3-methylphenyl)sulfonyloxane |
| SMILES | Cc1cccc(S(=O)(=O)[C@@]2(C)CCO[C@H](c3ccc(Cl)cc3)C2)c1 |
| InChI | InChI=1S/C19H21ClO3S/c1-14-4-3-5-17(12-14)24(21,22)19(2)10-11-23-18(13-19)15-6-8-16(20)9-7-15/h3-9,12,18H,10-11,13H2,1-2H3/t18-,19-/m0/s1 |
| InChIKey | IXCMENOMJRQMIP-OALUTQOASA-N |
| XLogP | 4.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.89 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |