C21H27F3N2O3S — CID 126764384
1-butyl-5-[4-methyl-4-(3-methylphenyl)sulfonyloxan-2-yl]-3-(trifluoromethyl)pyrazole (PubChem CID 126764384) has the molecular formula C21H27F3N2O3S and a molecular weight of 444.52 g/mol. Its IUPAC name is 1-butyl-5-[4-methyl-4-(3-methylphenyl)sulfonyloxan-2-yl]-3-(trifluoromethyl)pyrazole.
| Compound Name | 1-butyl-5-[4-methyl-4-(3-methylphenyl)sulfonyloxan-2-yl]-3-(trifluoromethyl)pyrazole |
|---|---|
| PubChem CID | 126764384 |
| Molecular Formula | C21H27F3N2O3S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 1-butyl-5-[4-methyl-4-(3-methylphenyl)sulfonyloxan-2-yl]-3-(trifluoromethyl)pyrazole |
| SMILES | CCCCn1nc(C(F)(F)F)cc1C1CC(C)(S(=O)(=O)c2cccc(C)c2)CCO1 |
| InChI | InChI=1S/C21H27F3N2O3S/c1-4-5-10-26-17(13-19(25-26)21(22,23)24)18-14-20(3,9-11-29-18)30(27,28)16-8-6-7-15(2)12-16/h6-8,12-13,18H,4-5,9-11,14H2,1-3H3 |
| InChIKey | YIMLOLLDXWLTDL-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |