C21H23F3O5S2 — CID 118443654
4-methyl-4-(3-methylphenyl)sulfonyl-2-[3-methylsulfonyl-4-(trifluoromethyl)phenyl]oxane (PubChem CID 118443654) has the molecular formula C21H23F3O5S2 and a molecular weight of 476.54 g/mol. Its IUPAC name is 4-methyl-4-(3-methylphenyl)sulfonyl-2-[3-methylsulfonyl-4-(trifluoromethyl)phenyl]oxane.
| Compound Name | 4-methyl-4-(3-methylphenyl)sulfonyl-2-[3-methylsulfonyl-4-(trifluoromethyl)phenyl]oxane |
|---|---|
| PubChem CID | 118443654 |
| Molecular Formula | C21H23F3O5S2 |
| Molecular Weight | 476.54 g/mol |
| Exact Mass | 476.09 |
| IUPAC Name | 4-methyl-4-(3-methylphenyl)sulfonyl-2-[3-methylsulfonyl-4-(trifluoromethyl)phenyl]oxane |
| SMILES | Cc1cccc(S(=O)(=O)C2(C)CCOC(c3ccc(C(F)(F)F)c(S(C)(=O)=O)c3)C2)c1 |
| InChI | InChI=1S/C21H23F3O5S2/c1-14-5-4-6-16(11-14)31(27,28)20(2)9-10-29-18(13-20)15-7-8-17(21(22,23)24)19(12-15)30(3,25)26/h4-8,11-12,18H,9-10,13H2,1-3H3 |
| InChIKey | XJAZYQARYKCZKH-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.54 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |