C21H19F6O5S2- — CID 174834109
[3-[4-methyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxan-2-yl]-5-(trifluoromethyl)phenyl]methanesulfinate (PubChem CID 174834109) has the molecular formula C21H19F6O5S2- and a molecular weight of 529.50 g/mol. Its IUPAC name is [3-[4-methyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxan-2-yl]-5-(trifluoromethyl)phenyl]methanesulfinate.
| Compound Name | [3-[4-methyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxan-2-yl]-5-(trifluoromethyl)phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174834109 |
| Molecular Formula | C21H19F6O5S2- |
| Molecular Weight | 529.50 g/mol |
| Exact Mass | 529.06 |
| IUPAC Name | [3-[4-methyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxan-2-yl]-5-(trifluoromethyl)phenyl]methanesulfinate |
| SMILES | CC1(S(=O)(=O)c2cccc(C(F)(F)F)c2)CCOC(c2cc(CS(=O)[O-])cc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C21H20F6O5S2/c1-19(34(30,31)17-4-2-3-15(10-17)20(22,23)24)5-6-32-18(11-19)14-7-13(12-33(28)29)8-16(9-14)21(25,26)27/h2-4,7-10,18H,5-6,11-12H2,1H3,(H,28,29)/p-1 |
| InChIKey | LFMXZELLBWOXGJ-UHFFFAOYSA-M |
| XLogP | 5.19 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|