C17H19F3N2O4S — CID 118434295
2-methyl-3-[4-methyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxan-2-yl]-1H-pyrazol-5-one (PubChem CID 118434295) has the molecular formula C17H19F3N2O4S and a molecular weight of 404.41 g/mol. Its IUPAC name is 2-methyl-3-[4-methyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxan-2-yl]-1H-pyrazol-5-one.
| Compound Name | 2-methyl-3-[4-methyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxan-2-yl]-1H-pyrazol-5-one |
|---|---|
| PubChem CID | 118434295 |
| Molecular Formula | C17H19F3N2O4S |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 2-methyl-3-[4-methyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxan-2-yl]-1H-pyrazol-5-one |
| SMILES | Cn1[nH]c(=O)cc1C1CC(C)(S(=O)(=O)c2cccc(C(F)(F)F)c2)CCO1 |
| InChI | InChI=1S/C17H19F3N2O4S/c1-16(6-7-26-14(10-16)13-9-15(23)21-22(13)2)27(24,25)12-5-3-4-11(8-12)17(18,19)20/h3-5,8-9,14H,6-7,10H2,1-2H3,(H,21,23) |
| InChIKey | NOJVVRXWPWLTMG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |