C19H23F3N2O6S2 — CID 135353552
[1-(2-hydroxyethyl)-5-[4-methyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxan-2-yl]pyrazol-3-yl]methanesulfinic acid (PubChem CID 135353552) has the molecular formula C19H23F3N2O6S2 and a molecular weight of 496.53 g/mol. Its IUPAC name is [1-(2-hydroxyethyl)-5-[4-methyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxan-2-yl]pyrazol-3-yl]methanesulfinic acid.
| Compound Name | [1-(2-hydroxyethyl)-5-[4-methyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxan-2-yl]pyrazol-3-yl]methanesulfinic acid |
|---|---|
| PubChem CID | 135353552 |
| Molecular Formula | C19H23F3N2O6S2 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | [1-(2-hydroxyethyl)-5-[4-methyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxan-2-yl]pyrazol-3-yl]methanesulfinic acid |
| SMILES | CC1(S(=O)(=O)c2cccc(C(F)(F)F)c2)CCOC(c2cc(CS(=O)O)nn2CCO)C1 |
| InChI | InChI=1S/C19H23F3N2O6S2/c1-18(32(28,29)15-4-2-3-13(9-15)19(20,21)22)5-8-30-17(11-18)16-10-14(12-31(26)27)23-24(16)6-7-25/h2-4,9-10,17,25H,5-8,11-12H2,1H3,(H,26,27) |
| InChIKey | DSGXPMHSXCWVTQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|