C21H20F6O5S2 — CID 175304563
[2-[4-methyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxan-2-yl]-5-(trifluoromethyl)phenyl]methanesulfinic acid (PubChem CID 175304563) has the molecular formula C21H20F6O5S2 and a molecular weight of 530.51 g/mol. Its IUPAC name is [2-[4-methyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxan-2-yl]-5-(trifluoromethyl)phenyl]methanesulfinic acid.
| Compound Name | [2-[4-methyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxan-2-yl]-5-(trifluoromethyl)phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 175304563 |
| Molecular Formula | C21H20F6O5S2 |
| Molecular Weight | 530.51 g/mol |
| Exact Mass | 530.07 |
| IUPAC Name | [2-[4-methyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxan-2-yl]-5-(trifluoromethyl)phenyl]methanesulfinic acid |
| SMILES | CC1(S(=O)(=O)c2cccc(C(F)(F)F)c2)CCOC(c2ccc(C(F)(F)F)cc2CS(=O)O)C1 |
| InChI | InChI=1S/C21H20F6O5S2/c1-19(34(30,31)16-4-2-3-14(10-16)20(22,23)24)7-8-32-18(11-19)17-6-5-15(21(25,26)27)9-13(17)12-33(28)29/h2-6,9-10,18H,7-8,11-12H2,1H3,(H,28,29) |
| InChIKey | WHLHLWXAUPALRT-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.51 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|