C16H17F3N2O3S — CID 129023668
5-[4-methyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxan-2-yl]-1H-pyrazole (PubChem CID 129023668) has the molecular formula C16H17F3N2O3S and a molecular weight of 374.38 g/mol. Its IUPAC name is 5-[4-methyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxan-2-yl]-1H-pyrazole.
| Compound Name | 5-[4-methyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxan-2-yl]-1H-pyrazole |
|---|---|
| PubChem CID | 129023668 |
| Molecular Formula | C16H17F3N2O3S |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 5-[4-methyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxan-2-yl]-1H-pyrazole |
| SMILES | CC1(S(=O)(=O)c2cccc(C(F)(F)F)c2)CCOC(c2ccn[nH]2)C1 |
| InChI | InChI=1S/C16H17F3N2O3S/c1-15(6-8-24-14(10-15)13-5-7-20-21-13)25(22,23)12-4-2-3-11(9-12)16(17,18)19/h2-5,7,9,14H,6,8,10H2,1H3,(H,20,21) |
| InChIKey | PQTYLXPZIFIVSA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |