C18H16BrF4NO3S — CID 118434304
5-bromo-3-fluoro-2-[4-methyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxan-2-yl]pyridine (PubChem CID 118434304) has the molecular formula C18H16BrF4NO3S and a molecular weight of 482.29 g/mol. Its IUPAC name is 5-bromo-3-fluoro-2-[4-methyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxan-2-yl]pyridine.
| Compound Name | 5-bromo-3-fluoro-2-[4-methyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxan-2-yl]pyridine |
|---|---|
| PubChem CID | 118434304 |
| Molecular Formula | C18H16BrF4NO3S |
| Molecular Weight | 482.29 g/mol |
| Exact Mass | 481.00 |
| IUPAC Name | 5-bromo-3-fluoro-2-[4-methyl-4-[3-(trifluoromethyl)phenyl]sulfonyloxan-2-yl]pyridine |
| SMILES | CC1(S(=O)(=O)c2cccc(C(F)(F)F)c2)CCOC(c2ncc(Br)cc2F)C1 |
| InChI | InChI=1S/C18H16BrF4NO3S/c1-17(28(25,26)13-4-2-3-11(7-13)18(21,22)23)5-6-27-15(9-17)16-14(20)8-12(19)10-24-16/h2-4,7-8,10,15H,5-6,9H2,1H3 |
| InChIKey | BOBBEYUKHMQONN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.29 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |