C19H17BrF4O3S — CID 118432426
2-(4-bromophenyl)-4-[3-fluoro-5-(trifluoromethyl)phenyl]sulfonyl-4-methyloxane (PubChem CID 118432426) has the molecular formula C19H17BrF4O3S and a molecular weight of 481.31 g/mol. Its IUPAC name is 2-(4-bromophenyl)-4-[3-fluoro-5-(trifluoromethyl)phenyl]sulfonyl-4-methyloxane.
| Compound Name | 2-(4-bromophenyl)-4-[3-fluoro-5-(trifluoromethyl)phenyl]sulfonyl-4-methyloxane |
|---|---|
| PubChem CID | 118432426 |
| Molecular Formula | C19H17BrF4O3S |
| Molecular Weight | 481.31 g/mol |
| Exact Mass | 480.00 |
| IUPAC Name | 2-(4-bromophenyl)-4-[3-fluoro-5-(trifluoromethyl)phenyl]sulfonyl-4-methyloxane |
| SMILES | CC1(S(=O)(=O)c2cc(F)cc(C(F)(F)F)c2)CCOC(c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C19H17BrF4O3S/c1-18(6-7-27-17(11-18)12-2-4-14(20)5-3-12)28(25,26)16-9-13(19(22,23)24)8-15(21)10-16/h2-5,8-10,17H,6-7,11H2,1H3 |
| InChIKey | XTIFUFPQVWPKQY-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.31 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |