C20H20F4O3S2 — CID 118432462
4-[3-fluoro-5-(trifluoromethyl)phenyl]sulfonyl-4-methyl-2-(4-methylsulfanylphenyl)oxane (PubChem CID 118432462) has the molecular formula C20H20F4O3S2 and a molecular weight of 448.50 g/mol. Its IUPAC name is 4-[3-fluoro-5-(trifluoromethyl)phenyl]sulfonyl-4-methyl-2-(4-methylsulfanylphenyl)oxane.
| Compound Name | 4-[3-fluoro-5-(trifluoromethyl)phenyl]sulfonyl-4-methyl-2-(4-methylsulfanylphenyl)oxane |
|---|---|
| PubChem CID | 118432462 |
| Molecular Formula | C20H20F4O3S2 |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 4-[3-fluoro-5-(trifluoromethyl)phenyl]sulfonyl-4-methyl-2-(4-methylsulfanylphenyl)oxane |
| SMILES | CSc1ccc(C2CC(C)(S(=O)(=O)c3cc(F)cc(C(F)(F)F)c3)CCO2)cc1 |
| InChI | InChI=1S/C20H20F4O3S2/c1-19(7-8-27-18(12-19)13-3-5-16(28-2)6-4-13)29(25,26)17-10-14(20(22,23)24)9-15(21)11-17/h3-6,9-11,18H,7-8,12H2,1-2H3 |
| InChIKey | SHBLMQOFAZEJSN-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |