C22H27FO6S2 — CID 118432522
2-(2-fluoro-4-methylsulfonylphenyl)-4-methyl-4-(3-propan-2-yloxyphenyl)sulfonyloxane (PubChem CID 118432522) has the molecular formula C22H27FO6S2 and a molecular weight of 470.58 g/mol. Its IUPAC name is 2-(2-fluoro-4-methylsulfonylphenyl)-4-methyl-4-(3-propan-2-yloxyphenyl)sulfonyloxane.
| Compound Name | 2-(2-fluoro-4-methylsulfonylphenyl)-4-methyl-4-(3-propan-2-yloxyphenyl)sulfonyloxane |
|---|---|
| PubChem CID | 118432522 |
| Molecular Formula | C22H27FO6S2 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | 2-(2-fluoro-4-methylsulfonylphenyl)-4-methyl-4-(3-propan-2-yloxyphenyl)sulfonyloxane |
| SMILES | CC(C)Oc1cccc(S(=O)(=O)C2(C)CCOC(c3ccc(S(C)(=O)=O)cc3F)C2)c1 |
| InChI | InChI=1S/C22H27FO6S2/c1-15(2)29-16-6-5-7-18(12-16)31(26,27)22(3)10-11-28-21(14-22)19-9-8-17(13-20(19)23)30(4,24)25/h5-9,12-13,15,21H,10-11,14H2,1-4H3 |
| InChIKey | PYRSNBLRMYSZAN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |