C20H22BrFO4S — CID 118432416
2-(4-bromo-2-fluorophenyl)-4-(3-propan-2-yloxyphenyl)sulfonyloxane (PubChem CID 118432416) has the molecular formula C20H22BrFO4S and a molecular weight of 457.36 g/mol. Its IUPAC name is 2-(4-bromo-2-fluorophenyl)-4-(3-propan-2-yloxyphenyl)sulfonyloxane.
| Compound Name | 2-(4-bromo-2-fluorophenyl)-4-(3-propan-2-yloxyphenyl)sulfonyloxane |
|---|---|
| PubChem CID | 118432416 |
| Molecular Formula | C20H22BrFO4S |
| Molecular Weight | 457.36 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | 2-(4-bromo-2-fluorophenyl)-4-(3-propan-2-yloxyphenyl)sulfonyloxane |
| SMILES | CC(C)Oc1cccc(S(=O)(=O)C2CCOC(c3ccc(Br)cc3F)C2)c1 |
| InChI | InChI=1S/C20H22BrFO4S/c1-13(2)26-15-4-3-5-16(11-15)27(23,24)17-8-9-25-20(12-17)18-7-6-14(21)10-19(18)22/h3-7,10-11,13,17,20H,8-9,12H2,1-2H3 |
| InChIKey | KCWBGCPCUJIEKG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.36 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |