C12H14BrNO4S — CID 136582516
(2S,3R)-N-(3-bromophenyl)sulfonyl-3-methyloxolane-2-carboxamide (PubChem CID 136582516) has the molecular formula C12H14BrNO4S and a molecular weight of 348.22 g/mol. Its IUPAC name is (2S,3R)-N-(3-bromophenyl)sulfonyl-3-methyloxolane-2-carboxamide.
| Compound Name | (2S,3R)-N-(3-bromophenyl)sulfonyl-3-methyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 136582516 |
| Molecular Formula | C12H14BrNO4S |
| Molecular Weight | 348.22 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | (2S,3R)-N-(3-bromophenyl)sulfonyl-3-methyloxolane-2-carboxamide |
| SMILES | C[C@@H]1CCO[C@@H]1C(=O)NS(=O)(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C12H14BrNO4S/c1-8-5-6-18-11(8)12(15)14-19(16,17)10-4-2-3-9(13)7-10/h2-4,7-8,11H,5-6H2,1H3,(H,14,15)/t8-,11+/m1/s1 |
| InChIKey | HDUKAXJYQLVEEJ-KCJUWKMLSA-N |
| XLogP | 1.68 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.22 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |