C23H31F5N2O4SSi — CID 140929956
2-[[5-(1,1-difluoroethyl)-3-[4-[3-(trifluoromethyl)phenyl]sulfonyloxan-2-yl]pyrazol-1-yl]methoxy]ethyl-trimethylsilane (PubChem CID 140929956) has the molecular formula C23H31F5N2O4SSi and a molecular weight of 554.65 g/mol. Its IUPAC name is 2-[[5-(1,1-difluoroethyl)-3-[4-[3-(trifluoromethyl)phenyl]sulfonyloxan-2-yl]pyrazol-1-yl]methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[[5-(1,1-difluoroethyl)-3-[4-[3-(trifluoromethyl)phenyl]sulfonyloxan-2-yl]pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 140929956 |
| Molecular Formula | C23H31F5N2O4SSi |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.17 |
| IUPAC Name | 2-[[5-(1,1-difluoroethyl)-3-[4-[3-(trifluoromethyl)phenyl]sulfonyloxan-2-yl]pyrazol-1-yl]methoxy]ethyl-trimethylsilane |
| SMILES | CC(F)(F)c1cc(C2CC(S(=O)(=O)c3cccc(C(F)(F)F)c3)CCO2)nn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C23H31F5N2O4SSi/c1-22(24,25)21-14-19(29-30(21)15-33-10-11-36(2,3)4)20-13-18(8-9-34-20)35(31,32)17-7-5-6-16(12-17)23(26,27)28/h5-7,12,14,18,20H,8-11,13,15H2,1-4H3 |
| InChIKey | YJMZPDFAMYDNEZ-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|