C23H33F3N2O4SSi — CID 157200443
trimethyl-[2-[[5-[4-(3-methylphenyl)sulfonyloxan-2-yl]-3-(2,2,2-trifluoroethyl)pyrazol-1-yl]methoxy]ethyl]silane (PubChem CID 157200443) has the molecular formula C23H33F3N2O4SSi and a molecular weight of 518.67 g/mol. Its IUPAC name is trimethyl-[2-[[5-[4-(3-methylphenyl)sulfonyloxan-2-yl]-3-(2,2,2-trifluoroethyl)pyrazol-1-yl]methoxy]ethyl]silane.
| Compound Name | trimethyl-[2-[[5-[4-(3-methylphenyl)sulfonyloxan-2-yl]-3-(2,2,2-trifluoroethyl)pyrazol-1-yl]methoxy]ethyl]silane |
|---|---|
| PubChem CID | 157200443 |
| Molecular Formula | C23H33F3N2O4SSi |
| Molecular Weight | 518.67 g/mol |
| Exact Mass | 518.19 |
| IUPAC Name | trimethyl-[2-[[5-[4-(3-methylphenyl)sulfonyloxan-2-yl]-3-(2,2,2-trifluoroethyl)pyrazol-1-yl]methoxy]ethyl]silane |
| SMILES | Cc1cccc(S(=O)(=O)C2CCOC(c3cc(CC(F)(F)F)nn3COCC[Si](C)(C)C)C2)c1 |
| InChI | InChI=1S/C23H33F3N2O4SSi/c1-17-6-5-7-19(12-17)33(29,30)20-8-9-32-22(14-20)21-13-18(15-23(24,25)26)27-28(21)16-31-10-11-34(2,3)4/h5-7,12-13,20,22H,8-11,14-16H2,1-4H3 |
| InChIKey | WMDBKSKVRDOYDR-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.67 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|