C14H24N2O2Si — CID 171529389
3-(cyclopropylmethyl)-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carbaldehyde (PubChem CID 171529389) has the molecular formula C14H24N2O2Si and a molecular weight of 280.44 g/mol. Its IUPAC name is 3-(cyclopropylmethyl)-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carbaldehyde.
| Compound Name | 3-(cyclopropylmethyl)-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carbaldehyde |
|---|---|
| PubChem CID | 171529389 |
| Molecular Formula | C14H24N2O2Si |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 3-(cyclopropylmethyl)-1-(2-trimethylsilylethoxymethyl)pyrazole-5-carbaldehyde |
| SMILES | C[Si](C)(C)CCOCn1nc(CC2CC2)cc1C=O |
| InChI | InChI=1S/C14H24N2O2Si/c1-19(2,3)7-6-18-11-16-14(10-17)9-13(15-16)8-12-4-5-12/h9-10,12H,4-8,11H2,1-3H3 |
| InChIKey | INSJTFZUSPOZNR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|