C11H18N2O3Si — CID 164719027
1-(2-trimethylsilylethoxymethyl)pyrazole-3,5-dicarbaldehyde (PubChem CID 164719027) has the molecular formula C11H18N2O3Si and a molecular weight of 254.36 g/mol. Its IUPAC name is 1-(2-trimethylsilylethoxymethyl)pyrazole-3,5-dicarbaldehyde.
| Compound Name | 1-(2-trimethylsilylethoxymethyl)pyrazole-3,5-dicarbaldehyde |
|---|---|
| PubChem CID | 164719027 |
| Molecular Formula | C11H18N2O3Si |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 1-(2-trimethylsilylethoxymethyl)pyrazole-3,5-dicarbaldehyde |
| SMILES | C[Si](C)(C)CCOCn1nc(C=O)cc1C=O |
| InChI | InChI=1S/C11H18N2O3Si/c1-17(2,3)5-4-16-9-13-11(8-15)6-10(7-14)12-13/h6-8H,4-5,9H2,1-3H3 |
| InChIKey | WFOSOHOUQVBIHZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|