C15H22N2O3Si — CID 174175818
5-methyl-4-oxo-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridine-2-carbaldehyde (PubChem CID 174175818) has the molecular formula C15H22N2O3Si and a molecular weight of 306.44 g/mol. Its IUPAC name is 5-methyl-4-oxo-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridine-2-carbaldehyde.
| Compound Name | 5-methyl-4-oxo-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridine-2-carbaldehyde |
|---|---|
| PubChem CID | 174175818 |
| Molecular Formula | C15H22N2O3Si |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 5-methyl-4-oxo-1-(2-trimethylsilylethoxymethyl)pyrrolo[3,2-c]pyridine-2-carbaldehyde |
| SMILES | Cn1ccc2c(cc(C=O)n2COCC[Si](C)(C)C)c1=O |
| InChI | InChI=1S/C15H22N2O3Si/c1-16-6-5-14-13(15(16)19)9-12(10-18)17(14)11-20-7-8-21(2,3)4/h5-6,9-10H,7-8,11H2,1-4H3 |
| InChIKey | HQNMJZAZGDMCGN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 53.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|