C15H22N2O2Si — CID 164900212
5-methyl-1-(2-trimethylsilylethoxymethyl)indazole-4-carbaldehyde (PubChem CID 164900212) has the molecular formula C15H22N2O2Si and a molecular weight of 290.44 g/mol. Its IUPAC name is 5-methyl-1-(2-trimethylsilylethoxymethyl)indazole-4-carbaldehyde.
| Compound Name | 5-methyl-1-(2-trimethylsilylethoxymethyl)indazole-4-carbaldehyde |
|---|---|
| PubChem CID | 164900212 |
| Molecular Formula | C15H22N2O2Si |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 5-methyl-1-(2-trimethylsilylethoxymethyl)indazole-4-carbaldehyde |
| SMILES | Cc1ccc2c(cnn2COCC[Si](C)(C)C)c1C=O |
| InChI | InChI=1S/C15H22N2O2Si/c1-12-5-6-15-13(14(12)10-18)9-16-17(15)11-19-7-8-20(2,3)4/h5-6,9-10H,7-8,11H2,1-4H3 |
| InChIKey | GFFZYPZALAFZDA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|