C13H18BrClN2OSi — CID 177341411
2-[(6-bromo-4-chloroindazol-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 177341411) has the molecular formula C13H18BrClN2OSi and a molecular weight of 361.74 g/mol. Its IUPAC name is 2-[(6-bromo-4-chloroindazol-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(6-bromo-4-chloroindazol-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 177341411 |
| Molecular Formula | C13H18BrClN2OSi |
| Molecular Weight | 361.74 g/mol |
| Exact Mass | 360.01 |
| IUPAC Name | 2-[(6-bromo-4-chloroindazol-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | C[Si](C)(C)CCOCn1ncc2c(Cl)cc(Br)cc21 |
| InChI | InChI=1S/C13H18BrClN2OSi/c1-19(2,3)5-4-18-9-17-13-7-10(14)6-12(15)11(13)8-16-17/h6-8H,4-5,9H2,1-3H3 |
| InChIKey | LBQILBFFEDZRCZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.74 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|