C17H22BrClN2O2Si — CID 177326996
4-[4-bromo-6-chloro-1-(2-trimethylsilylethoxymethyl)indazol-5-yl]but-3-yn-1-ol (PubChem CID 177326996) has the molecular formula C17H22BrClN2O2Si and a molecular weight of 429.82 g/mol. Its IUPAC name is 4-[4-bromo-6-chloro-1-(2-trimethylsilylethoxymethyl)indazol-5-yl]but-3-yn-1-ol.
| Compound Name | 4-[4-bromo-6-chloro-1-(2-trimethylsilylethoxymethyl)indazol-5-yl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 177326996 |
| Molecular Formula | C17H22BrClN2O2Si |
| Molecular Weight | 429.82 g/mol |
| Exact Mass | 428.03 |
| IUPAC Name | 4-[4-bromo-6-chloro-1-(2-trimethylsilylethoxymethyl)indazol-5-yl]but-3-yn-1-ol |
| SMILES | C[Si](C)(C)CCOCn1ncc2c(Br)c(C#CCCO)c(Cl)cc21 |
| InChI | InChI=1S/C17H22BrClN2O2Si/c1-24(2,3)9-8-23-12-21-16-10-15(19)13(6-4-5-7-22)17(18)14(16)11-20-21/h10-11,22H,5,7-9,12H2,1-3H3 |
| InChIKey | CGICMKVNFLOBDC-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.82 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|