C15H24N2OSi — CID 174041088
2-[(4,5-dimethylindazol-1-yl)methoxy]ethyl-trimethylsilane (PubChem CID 174041088) has the molecular formula C15H24N2OSi and a molecular weight of 276.46 g/mol. Its IUPAC name is 2-[(4,5-dimethylindazol-1-yl)methoxy]ethyl-trimethylsilane.
| Compound Name | 2-[(4,5-dimethylindazol-1-yl)methoxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 174041088 |
| Molecular Formula | C15H24N2OSi |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | 2-[(4,5-dimethylindazol-1-yl)methoxy]ethyl-trimethylsilane |
| SMILES | Cc1ccc2c(cnn2COCC[Si](C)(C)C)c1C |
| InChI | InChI=1S/C15H24N2OSi/c1-12-6-7-15-14(13(12)2)10-16-17(15)11-18-8-9-19(3,4)5/h6-7,10H,8-9,11H2,1-5H3 |
| InChIKey | BBKOCTOKCCHKRW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|