C26H33N5O2Si — CID 167374682
N-[1-methyl-2-[4-methyl-1-(2-trimethylsilylethoxymethyl)indazol-5-yl]pyrrolo[2,3-c]pyridin-5-yl]cyclopropanecarboxamide (PubChem CID 167374682) has the molecular formula C26H33N5O2Si and a molecular weight of 475.67 g/mol. Its IUPAC name is N-[1-methyl-2-[4-methyl-1-(2-trimethylsilylethoxymethyl)indazol-5-yl]pyrrolo[2,3-c]pyridin-5-yl]cyclopropanecarboxamide.
| Compound Name | N-[1-methyl-2-[4-methyl-1-(2-trimethylsilylethoxymethyl)indazol-5-yl]pyrrolo[2,3-c]pyridin-5-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 167374682 |
| Molecular Formula | C26H33N5O2Si |
| Molecular Weight | 475.67 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | N-[1-methyl-2-[4-methyl-1-(2-trimethylsilylethoxymethyl)indazol-5-yl]pyrrolo[2,3-c]pyridin-5-yl]cyclopropanecarboxamide |
| SMILES | Cc1c(-c2cc3cc(NC(=O)C4CC4)ncc3n2C)ccc2c1cnn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C26H33N5O2Si/c1-17-20(8-9-22-21(17)14-28-31(22)16-33-10-11-34(3,4)5)23-12-19-13-25(27-15-24(19)30(23)2)29-26(32)18-6-7-18/h8-9,12-15,18H,6-7,10-11,16H2,1-5H3,(H,27,29,32) |
| InChIKey | PFWQKUSOXRFKNE-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 73.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.67 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|