C27H34N4O2Si — CID 167374759
N-[1-methyl-2-[6-methyl-1-(2-trimethylsilylethoxymethyl)indol-5-yl]pyrrolo[2,3-c]pyridin-5-yl]cyclopropanecarboxamide (PubChem CID 167374759) has the molecular formula C27H34N4O2Si and a molecular weight of 474.68 g/mol. Its IUPAC name is N-[1-methyl-2-[6-methyl-1-(2-trimethylsilylethoxymethyl)indol-5-yl]pyrrolo[2,3-c]pyridin-5-yl]cyclopropanecarboxamide.
| Compound Name | N-[1-methyl-2-[6-methyl-1-(2-trimethylsilylethoxymethyl)indol-5-yl]pyrrolo[2,3-c]pyridin-5-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 167374759 |
| Molecular Formula | C27H34N4O2Si |
| Molecular Weight | 474.68 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | N-[1-methyl-2-[6-methyl-1-(2-trimethylsilylethoxymethyl)indol-5-yl]pyrrolo[2,3-c]pyridin-5-yl]cyclopropanecarboxamide |
| SMILES | Cc1cc2c(ccn2COCC[Si](C)(C)C)cc1-c1cc2cc(NC(=O)C3CC3)ncc2n1C |
| InChI | InChI=1S/C27H34N4O2Si/c1-18-12-23-20(8-9-31(23)17-33-10-11-34(3,4)5)13-22(18)24-14-21-15-26(28-16-25(21)30(24)2)29-27(32)19-6-7-19/h8-9,12-16,19H,6-7,10-11,17H2,1-5H3,(H,28,29,32) |
| InChIKey | HCQNBSANRATKGO-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 61.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.68 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|